C10H20N2O3S — CID 64643013
2-amino-2-cyclopropyl-N-(1-methylsulfonylpropan-2-yl)propanamide (PubChem CID 64643013) has the molecular formula C10H20N2O3S and a molecular weight of 248.35 g/mol. Its IUPAC name is 2-amino-2-cyclopropyl-N-(1-methylsulfonylpropan-2-yl)propanamide.
| Compound Name | 2-amino-2-cyclopropyl-N-(1-methylsulfonylpropan-2-yl)propanamide |
|---|---|
| PubChem CID | 64643013 |
| Molecular Formula | C10H20N2O3S |
| Molecular Weight | 248.35 g/mol |
| Exact Mass | 248.12 |
| IUPAC Name | 2-amino-2-cyclopropyl-N-(1-methylsulfonylpropan-2-yl)propanamide |
| SMILES | CC(CS(C)(=O)=O)NC(=O)C(C)(N)C1CC1 |
| InChI | InChI=1S/C10H20N2O3S/c1-7(6-16(3,14)15)12-9(13)10(2,11)8-4-5-8/h7-8H,4-6,11H2,1-3H3,(H,12,13) |
| InChIKey | PDTBDSVTKVBDCT-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.35 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |