C16H25N3O — CID 6464332
1-(2,5-dimethylphenyl)-3-(2-piperidin-1-ylethyl)urea (PubChem CID 6464332) has the molecular formula C16H25N3O and a molecular weight of 275.40 g/mol. Its IUPAC name is 1-(2,5-dimethylphenyl)-3-(2-piperidin-1-ylethyl)urea.
| Compound Name | 1-(2,5-dimethylphenyl)-3-(2-piperidin-1-ylethyl)urea |
|---|---|
| PubChem CID | 6464332 |
| Molecular Formula | C16H25N3O |
| Molecular Weight | 275.40 g/mol |
| Exact Mass | 275.20 |
| IUPAC Name | 1-(2,5-dimethylphenyl)-3-(2-piperidin-1-ylethyl)urea |
| SMILES | Cc1ccc(C)c(NC(=O)NCCN2CCCCC2)c1 |
| InChI | InChI=1S/C16H25N3O/c1-13-6-7-14(2)15(12-13)18-16(20)17-8-11-19-9-4-3-5-10-19/h6-7,12H,3-5,8-11H2,1-2H3,(H2,17,18,20) |
| InChIKey | CYBYJOWDROKGLM-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.40 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |