C11H13F2NO2S — CID 64646053
1-cyclopropyl-2-(2,4-difluorophenyl)sulfonylethanamine (PubChem CID 64646053) has the molecular formula C11H13F2NO2S and a molecular weight of 261.29 g/mol. Its IUPAC name is 1-cyclopropyl-2-(2,4-difluorophenyl)sulfonylethanamine.
| Compound Name | 1-cyclopropyl-2-(2,4-difluorophenyl)sulfonylethanamine |
|---|---|
| PubChem CID | 64646053 |
| Molecular Formula | C11H13F2NO2S |
| Molecular Weight | 261.29 g/mol |
| Exact Mass | 261.06 |
| IUPAC Name | 1-cyclopropyl-2-(2,4-difluorophenyl)sulfonylethanamine |
| SMILES | NC(CS(=O)(=O)c1ccc(F)cc1F)C1CC1 |
| InChI | InChI=1S/C11H13F2NO2S/c12-8-3-4-11(9(13)5-8)17(15,16)6-10(14)7-1-2-7/h3-5,7,10H,1-2,6,14H2 |
| InChIKey | VWDVANNYSRZOCA-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.29 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |