C16H24BrNO2S — CID 64646653
2-(4-bromophenyl)sulfonyl-N-methyl-4-propylcyclohexan-1-amine (PubChem CID 64646653) has the molecular formula C16H24BrNO2S and a molecular weight of 374.34 g/mol. Its IUPAC name is 2-(4-bromophenyl)sulfonyl-N-methyl-4-propylcyclohexan-1-amine.
| Compound Name | 2-(4-bromophenyl)sulfonyl-N-methyl-4-propylcyclohexan-1-amine |
|---|---|
| PubChem CID | 64646653 |
| Molecular Formula | C16H24BrNO2S |
| Molecular Weight | 374.34 g/mol |
| Exact Mass | 373.07 |
| IUPAC Name | 2-(4-bromophenyl)sulfonyl-N-methyl-4-propylcyclohexan-1-amine |
| SMILES | CCCC1CCC(NC)C(S(=O)(=O)c2ccc(Br)cc2)C1 |
| InChI | InChI=1S/C16H24BrNO2S/c1-3-4-12-5-10-15(18-2)16(11-12)21(19,20)14-8-6-13(17)7-9-14/h6-9,12,15-16,18H,3-5,10-11H2,1-2H3 |
| InChIKey | RFXXUBLMWOOOFK-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.34 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |