C15H25NO4S — CID 64646885
2-butan-2-ylsulfonyl-1-(2,4-dimethoxyphenyl)-N-methylethanamine (PubChem CID 64646885) has the molecular formula C15H25NO4S and a molecular weight of 315.44 g/mol. Its IUPAC name is 2-butan-2-ylsulfonyl-1-(2,4-dimethoxyphenyl)-N-methylethanamine.
| Compound Name | 2-butan-2-ylsulfonyl-1-(2,4-dimethoxyphenyl)-N-methylethanamine |
|---|---|
| PubChem CID | 64646885 |
| Molecular Formula | C15H25NO4S |
| Molecular Weight | 315.44 g/mol |
| Exact Mass | 315.15 |
| IUPAC Name | 2-butan-2-ylsulfonyl-1-(2,4-dimethoxyphenyl)-N-methylethanamine |
| SMILES | CCC(C)S(=O)(=O)CC(NC)c1ccc(OC)cc1OC |
| InChI | InChI=1S/C15H25NO4S/c1-6-11(2)21(17,18)10-14(16-3)13-8-7-12(19-4)9-15(13)20-5/h7-9,11,14,16H,6,10H2,1-5H3 |
| InChIKey | MISWWRHXGBNNEP-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.44 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |