C16H24N2OS — CID 64649552
N-[4-(2-amino-5,5-dimethylcyclohexyl)sulfanylphenyl]acetamide (PubChem CID 64649552) has the molecular formula C16H24N2OS and a molecular weight of 292.45 g/mol. Its IUPAC name is N-[4-(2-amino-5,5-dimethylcyclohexyl)sulfanylphenyl]acetamide.
| Compound Name | N-[4-(2-amino-5,5-dimethylcyclohexyl)sulfanylphenyl]acetamide |
|---|---|
| PubChem CID | 64649552 |
| Molecular Formula | C16H24N2OS |
| Molecular Weight | 292.45 g/mol |
| Exact Mass | 292.16 |
| IUPAC Name | N-[4-(2-amino-5,5-dimethylcyclohexyl)sulfanylphenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(SC2CC(C)(C)CCC2N)cc1 |
| InChI | InChI=1S/C16H24N2OS/c1-11(19)18-12-4-6-13(7-5-12)20-15-10-16(2,3)9-8-14(15)17/h4-7,14-15H,8-10,17H2,1-3H3,(H,18,19) |
| InChIKey | IEFUXUZWJBRPMF-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.45 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |