C17H28N2OS — CID 64649556
N-[4-[5-(propylamino)hexylsulfanyl]phenyl]acetamide (PubChem CID 64649556) has the molecular formula C17H28N2OS and a molecular weight of 308.49 g/mol. Its IUPAC name is N-[4-[5-(propylamino)hexylsulfanyl]phenyl]acetamide.
| Compound Name | N-[4-[5-(propylamino)hexylsulfanyl]phenyl]acetamide |
|---|---|
| PubChem CID | 64649556 |
| Molecular Formula | C17H28N2OS |
| Molecular Weight | 308.49 g/mol |
| Exact Mass | 308.19 |
| IUPAC Name | N-[4-[5-(propylamino)hexylsulfanyl]phenyl]acetamide |
| SMILES | CCCNC(C)CCCCSc1ccc(NC(C)=O)cc1 |
| InChI | InChI=1S/C17H28N2OS/c1-4-12-18-14(2)7-5-6-13-21-17-10-8-16(9-11-17)19-15(3)20/h8-11,14,18H,4-7,12-13H2,1-3H3,(H,19,20) |
| InChIKey | BVXMOXLIUANHRK-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.49 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|