C16H23F2NOS — CID 64651180
2-(2,4-difluorophenyl)sulfinyl-N-propylcycloheptan-1-amine (PubChem CID 64651180) has the molecular formula C16H23F2NOS and a molecular weight of 315.43 g/mol. Its IUPAC name is 2-(2,4-difluorophenyl)sulfinyl-N-propylcycloheptan-1-amine.
| Compound Name | 2-(2,4-difluorophenyl)sulfinyl-N-propylcycloheptan-1-amine |
|---|---|
| PubChem CID | 64651180 |
| Molecular Formula | C16H23F2NOS |
| Molecular Weight | 315.43 g/mol |
| Exact Mass | 315.15 |
| IUPAC Name | 2-(2,4-difluorophenyl)sulfinyl-N-propylcycloheptan-1-amine |
| SMILES | CCCNC1CCCCCC1S(=O)c1ccc(F)cc1F |
| InChI | InChI=1S/C16H23F2NOS/c1-2-10-19-14-6-4-3-5-7-16(14)21(20)15-9-8-12(17)11-13(15)18/h8-9,11,14,16,19H,2-7,10H2,1H3 |
| InChIKey | VIWZHTNBRJXDPT-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.43 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |