About 5-[1-(2,4-dichloro-5-fluorophenyl)ethylamino]-1-methylpiperidin-2-one
5-[1-(2,4-dichloro-5-fluorophenyl)ethylamino]-1-methylpiperidin-2-one (PubChem CID 64654470) has the molecular formula C14H17Cl2FN2O
and a molecular weight of 319.21 g/mol. Its IUPAC name is 5-[1-(2,4-dichloro-5-fluorophenyl)ethylamino]-1-methylpiperidin-2-one.
Molecular Properties
| Compound Name | 5-[1-(2,4-dichloro-5-fluorophenyl)ethylamino]-1-methylpiperidin-2-one |
| PubChem CID | 64654470 |
| Molecular Formula | C14H17Cl2FN2O |
| Molecular Weight | 319.21 g/mol |
| Exact Mass | 318.07 |
| IUPAC Name | 5-[1-(2,4-dichloro-5-fluorophenyl)ethylamino]-1-methylpiperidin-2-one |
| SMILES | CC(NC1CCC(=O)N(C)C1)c1cc(F)c(Cl)cc1Cl |
| InChI | InChI=1S/C14H17Cl2FN2O/c1-8(10-5-13(17)12(16)6-11(10)15)18-9-3-4-14(20)19(2)7-9/h5-6,8-9,18H,3-4,7H2,1-2H3 |
| InChIKey | QRAITRKAYVEUSQ-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.21 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze 5-[1-(2,4-dichloro-5-fluorophenyl)ethylamino]-1-methylpiperidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[1-(2,4-dichloro-5-fluorophenyl)ethylamino]-1-methylpiperidin-2-one?
The IUPAC name of 5-[1-(2,4-dichloro-5-fluorophenyl)ethylamino]-1-methylpiperidin-2-one (CID 64654470) is 5-[1-(2,4-dichloro-5-fluorophenyl)ethylamino]-1-methylpiperidin-2-one.
What is the SMILES notation for 5-[1-(2,4-dichloro-5-fluorophenyl)ethylamino]-1-methylpiperidin-2-one?
The canonical SMILES for 5-[1-(2,4-dichloro-5-fluorophenyl)ethylamino]-1-methylpiperidin-2-one is CC(NC1CCC(=O)N(C)C1)c1cc(F)c(Cl)cc1Cl.
What is the InChIKey of 5-[1-(2,4-dichloro-5-fluorophenyl)ethylamino]-1-methylpiperidin-2-one?
The InChIKey is QRAITRKAYVEUSQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17Cl2FN2O/c1-8(10-5-13(17)12(16)6-11(10)15)18-9-3-4-14(20)19(2)7-9/h5-6,8-9,18H,3-4,7H2,1-2H3.
What are the key properties of 5-[1-(2,4-dichloro-5-fluorophenyl)ethylamino]-1-methylpiperidin-2-one?
5-[1-(2,4-dichloro-5-fluorophenyl)ethylamino]-1-methylpiperidin-2-one has a molecular weight of 319.21 g/mol, XLogP of 3.40, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[1-(2,4-dichloro-5-fluorophenyl)ethylamino]-1-methylpiperidin-2-one is sourced from PubChem (CID 64654470), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).