C15H15Cl2NOS — CID 64659491
2-(2,5-dichlorophenyl)sulfinyl-1-(2-methylphenyl)ethanamine (PubChem CID 64659491) has the molecular formula C15H15Cl2NOS and a molecular weight of 328.26 g/mol. Its IUPAC name is 2-(2,5-dichlorophenyl)sulfinyl-1-(2-methylphenyl)ethanamine.
| Compound Name | 2-(2,5-dichlorophenyl)sulfinyl-1-(2-methylphenyl)ethanamine |
|---|---|
| PubChem CID | 64659491 |
| Molecular Formula | C15H15Cl2NOS |
| Molecular Weight | 328.26 g/mol |
| Exact Mass | 327.03 |
| IUPAC Name | 2-(2,5-dichlorophenyl)sulfinyl-1-(2-methylphenyl)ethanamine |
| SMILES | Cc1ccccc1C(N)CS(=O)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C15H15Cl2NOS/c1-10-4-2-3-5-12(10)14(18)9-20(19)15-8-11(16)6-7-13(15)17/h2-8,14H,9,18H2,1H3 |
| InChIKey | RNTVYNFDJKVBJY-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.26 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |