C11H15Cl2NOS — CID 64660271
1-(2,5-dichlorophenyl)sulfinyl-N-ethylpropan-2-amine (PubChem CID 64660271) has the molecular formula C11H15Cl2NOS and a molecular weight of 280.22 g/mol. Its IUPAC name is 1-(2,5-dichlorophenyl)sulfinyl-N-ethylpropan-2-amine.
| Compound Name | 1-(2,5-dichlorophenyl)sulfinyl-N-ethylpropan-2-amine |
|---|---|
| PubChem CID | 64660271 |
| Molecular Formula | C11H15Cl2NOS |
| Molecular Weight | 280.22 g/mol |
| Exact Mass | 279.03 |
| IUPAC Name | 1-(2,5-dichlorophenyl)sulfinyl-N-ethylpropan-2-amine |
| SMILES | CCNC(C)CS(=O)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C11H15Cl2NOS/c1-3-14-8(2)7-16(15)11-6-9(12)4-5-10(11)13/h4-6,8,14H,3,7H2,1-2H3 |
| InChIKey | MCKRWLYGTFFYHO-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.22 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |