C11H12Cl2O2S — CID 64702900
4-(2,5-dichlorophenyl)sulfinylpentan-2-one (PubChem CID 64702900) has the molecular formula C11H12Cl2O2S and a molecular weight of 279.19 g/mol. Its IUPAC name is 4-(2,5-dichlorophenyl)sulfinylpentan-2-one.
| Compound Name | 4-(2,5-dichlorophenyl)sulfinylpentan-2-one |
|---|---|
| PubChem CID | 64702900 |
| Molecular Formula | C11H12Cl2O2S |
| Molecular Weight | 279.19 g/mol |
| Exact Mass | 277.99 |
| IUPAC Name | 4-(2,5-dichlorophenyl)sulfinylpentan-2-one |
| SMILES | CC(=O)CC(C)S(=O)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C11H12Cl2O2S/c1-7(14)5-8(2)16(15)11-6-9(12)3-4-10(11)13/h3-4,6,8H,5H2,1-2H3 |
| InChIKey | CHULXLOJJILVLU-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.19 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |