C13H21NO2S — CID 64660519
1-[3-(1-aminoethyl)phenyl]sulfanyl-3-ethoxypropan-2-ol (PubChem CID 64660519) has the molecular formula C13H21NO2S and a molecular weight of 255.38 g/mol. Its IUPAC name is 1-[3-(1-aminoethyl)phenyl]sulfanyl-3-ethoxypropan-2-ol.
| Compound Name | 1-[3-(1-aminoethyl)phenyl]sulfanyl-3-ethoxypropan-2-ol |
|---|---|
| PubChem CID | 64660519 |
| Molecular Formula | C13H21NO2S |
| Molecular Weight | 255.38 g/mol |
| Exact Mass | 255.13 |
| IUPAC Name | 1-[3-(1-aminoethyl)phenyl]sulfanyl-3-ethoxypropan-2-ol |
| SMILES | CCOCC(O)CSc1cccc(C(C)N)c1 |
| InChI | InChI=1S/C13H21NO2S/c1-3-16-8-12(15)9-17-13-6-4-5-11(7-13)10(2)14/h4-7,10,12,15H,3,8-9,14H2,1-2H3 |
| InChIKey | CREVXBJNVLKEFC-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.38 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |