C13H20O2S — CID 79566648
1-(3-methylphenyl)sulfanyl-3-propoxypropan-2-ol (PubChem CID 79566648) has the molecular formula C13H20O2S and a molecular weight of 240.37 g/mol. Its IUPAC name is 1-(3-methylphenyl)sulfanyl-3-propoxypropan-2-ol.
| Compound Name | 1-(3-methylphenyl)sulfanyl-3-propoxypropan-2-ol |
|---|---|
| PubChem CID | 79566648 |
| Molecular Formula | C13H20O2S |
| Molecular Weight | 240.37 g/mol |
| Exact Mass | 240.12 |
| IUPAC Name | 1-(3-methylphenyl)sulfanyl-3-propoxypropan-2-ol |
| SMILES | CCCOCC(O)CSc1cccc(C)c1 |
| InChI | InChI=1S/C13H20O2S/c1-3-7-15-9-12(14)10-16-13-6-4-5-11(2)8-13/h4-6,8,12,14H,3,7,9-10H2,1-2H3 |
| InChIKey | BRCIQJQGLSMDNX-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.37 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|