C15H23Cl2N — CID 64664799
N-tert-butyl-4-(2,6-dichlorophenyl)-2-methylbutan-1-amine (PubChem CID 64664799) has the molecular formula C15H23Cl2N and a molecular weight of 288.26 g/mol. Its IUPAC name is N-tert-butyl-4-(2,6-dichlorophenyl)-2-methylbutan-1-amine.
| Compound Name | N-tert-butyl-4-(2,6-dichlorophenyl)-2-methylbutan-1-amine |
|---|---|
| PubChem CID | 64664799 |
| Molecular Formula | C15H23Cl2N |
| Molecular Weight | 288.26 g/mol |
| Exact Mass | 287.12 |
| IUPAC Name | N-tert-butyl-4-(2,6-dichlorophenyl)-2-methylbutan-1-amine |
| SMILES | CC(CCc1c(Cl)cccc1Cl)CNC(C)(C)C |
| InChI | InChI=1S/C15H23Cl2N/c1-11(10-18-15(2,3)4)8-9-12-13(16)6-5-7-14(12)17/h5-7,11,18H,8-10H2,1-4H3 |
| InChIKey | PODBEUNMRGDAAF-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.26 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |