C15H25N — CID 64665620
3-(2,3-dimethylphenyl)-2-methyl-N-propylpropan-1-amine (PubChem CID 64665620) has the molecular formula C15H25N and a molecular weight of 219.37 g/mol. Its IUPAC name is 3-(2,3-dimethylphenyl)-2-methyl-N-propylpropan-1-amine.
| Compound Name | 3-(2,3-dimethylphenyl)-2-methyl-N-propylpropan-1-amine |
|---|---|
| PubChem CID | 64665620 |
| Molecular Formula | C15H25N |
| Molecular Weight | 219.37 g/mol |
| Exact Mass | 219.20 |
| IUPAC Name | 3-(2,3-dimethylphenyl)-2-methyl-N-propylpropan-1-amine |
| SMILES | CCCNCC(C)Cc1cccc(C)c1C |
| InChI | InChI=1S/C15H25N/c1-5-9-16-11-12(2)10-15-8-6-7-13(3)14(15)4/h6-8,12,16H,5,9-11H2,1-4H3 |
| InChIKey | VKPRGAPMFORXLH-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.37 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|