C14H21NO3S2 — CID 64666334
4-[3-[1-(ethylamino)ethyl]phenyl]sulfanyl-1,1-dioxothiolan-3-ol (PubChem CID 64666334) has the molecular formula C14H21NO3S2 and a molecular weight of 315.46 g/mol. Its IUPAC name is 4-[3-[1-(ethylamino)ethyl]phenyl]sulfanyl-1,1-dioxothiolan-3-ol.
| Compound Name | 4-[3-[1-(ethylamino)ethyl]phenyl]sulfanyl-1,1-dioxothiolan-3-ol |
|---|---|
| PubChem CID | 64666334 |
| Molecular Formula | C14H21NO3S2 |
| Molecular Weight | 315.46 g/mol |
| Exact Mass | 315.10 |
| IUPAC Name | 4-[3-[1-(ethylamino)ethyl]phenyl]sulfanyl-1,1-dioxothiolan-3-ol |
| SMILES | CCNC(C)c1cccc(SC2CS(=O)(=O)CC2O)c1 |
| InChI | InChI=1S/C14H21NO3S2/c1-3-15-10(2)11-5-4-6-12(7-11)19-14-9-20(17,18)8-13(14)16/h4-7,10,13-16H,3,8-9H2,1-2H3 |
| InChIKey | WNUAWSDNDOUHCC-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.46 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |