C13H19NO3S2 — CID 66347455
4-[3-(ethylaminomethyl)phenyl]sulfanyl-1,1-dioxothiolan-3-ol (PubChem CID 66347455) has the molecular formula C13H19NO3S2 and a molecular weight of 301.43 g/mol. Its IUPAC name is 4-[3-(ethylaminomethyl)phenyl]sulfanyl-1,1-dioxothiolan-3-ol.
| Compound Name | 4-[3-(ethylaminomethyl)phenyl]sulfanyl-1,1-dioxothiolan-3-ol |
|---|---|
| PubChem CID | 66347455 |
| Molecular Formula | C13H19NO3S2 |
| Molecular Weight | 301.43 g/mol |
| Exact Mass | 301.08 |
| IUPAC Name | 4-[3-(ethylaminomethyl)phenyl]sulfanyl-1,1-dioxothiolan-3-ol |
| SMILES | CCNCc1cccc(SC2CS(=O)(=O)CC2O)c1 |
| InChI | InChI=1S/C13H19NO3S2/c1-2-14-7-10-4-3-5-11(6-10)18-13-9-19(16,17)8-12(13)15/h3-6,12-15H,2,7-9H2,1H3 |
| InChIKey | ZPKZEXKWWHSREB-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.43 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |