C14H27NO2 — CID 64667349
ethyl 2-[(2,3-dimethylcyclohexyl)amino]butanoate (PubChem CID 64667349) has the molecular formula C14H27NO2 and a molecular weight of 241.37 g/mol. Its IUPAC name is ethyl 2-[(2,3-dimethylcyclohexyl)amino]butanoate.
| Compound Name | ethyl 2-[(2,3-dimethylcyclohexyl)amino]butanoate |
|---|---|
| PubChem CID | 64667349 |
| Molecular Formula | C14H27NO2 |
| Molecular Weight | 241.37 g/mol |
| Exact Mass | 241.20 |
| IUPAC Name | ethyl 2-[(2,3-dimethylcyclohexyl)amino]butanoate |
| SMILES | CCOC(=O)C(CC)NC1CCCC(C)C1C |
| InChI | InChI=1S/C14H27NO2/c1-5-12(14(16)17-6-2)15-13-9-7-8-10(3)11(13)4/h10-13,15H,5-9H2,1-4H3 |
| InChIKey | WPCFJCZJOWBVIN-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.37 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |