C16H27NO3S — CID 64674466
2-(3-methoxypropylsulfonyl)-1-[4-(2-methylpropyl)phenyl]ethanamine (PubChem CID 64674466) has the molecular formula C16H27NO3S and a molecular weight of 313.46 g/mol. Its IUPAC name is 2-(3-methoxypropylsulfonyl)-1-[4-(2-methylpropyl)phenyl]ethanamine.
| Compound Name | 2-(3-methoxypropylsulfonyl)-1-[4-(2-methylpropyl)phenyl]ethanamine |
|---|---|
| PubChem CID | 64674466 |
| Molecular Formula | C16H27NO3S |
| Molecular Weight | 313.46 g/mol |
| Exact Mass | 313.17 |
| IUPAC Name | 2-(3-methoxypropylsulfonyl)-1-[4-(2-methylpropyl)phenyl]ethanamine |
| SMILES | COCCCS(=O)(=O)CC(N)c1ccc(CC(C)C)cc1 |
| InChI | InChI=1S/C16H27NO3S/c1-13(2)11-14-5-7-15(8-6-14)16(17)12-21(18,19)10-4-9-20-3/h5-8,13,16H,4,9-12,17H2,1-3H3 |
| InChIKey | DQZMXFUDTGHXOI-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.46 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|