C16H21FN4O2S — CID 6467767
1-(1-ethylpyrazol-4-yl)sulfonyl-4-[(4-fluorophenyl)methyl]piperazine (PubChem CID 6467767) has the molecular formula C16H21FN4O2S and a molecular weight of 352.44 g/mol. Its IUPAC name is 1-(1-ethylpyrazol-4-yl)sulfonyl-4-[(4-fluorophenyl)methyl]piperazine.
| Compound Name | 1-(1-ethylpyrazol-4-yl)sulfonyl-4-[(4-fluorophenyl)methyl]piperazine |
|---|---|
| PubChem CID | 6467767 |
| Molecular Formula | C16H21FN4O2S |
| Molecular Weight | 352.44 g/mol |
| Exact Mass | 352.14 |
| IUPAC Name | 1-(1-ethylpyrazol-4-yl)sulfonyl-4-[(4-fluorophenyl)methyl]piperazine |
| SMILES | CCn1cc(S(=O)(=O)N2CCN(Cc3ccc(F)cc3)CC2)cn1 |
| InChI | InChI=1S/C16H21FN4O2S/c1-2-20-13-16(11-18-20)24(22,23)21-9-7-19(8-10-21)12-14-3-5-15(17)6-4-14/h3-6,11,13H,2,7-10,12H2,1H3 |
| InChIKey | FWBZVRDQSZPTTO-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 58.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.44 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |