C15H20N4O2S — CID 6464253
1-(1,3-dimethylpyrazol-4-yl)sulfonyl-4-phenylpiperazine (PubChem CID 6464253) has the molecular formula C15H20N4O2S and a molecular weight of 320.42 g/mol. Its IUPAC name is 1-(1,3-dimethylpyrazol-4-yl)sulfonyl-4-phenylpiperazine.
| Compound Name | 1-(1,3-dimethylpyrazol-4-yl)sulfonyl-4-phenylpiperazine |
|---|---|
| PubChem CID | 6464253 |
| Molecular Formula | C15H20N4O2S |
| Molecular Weight | 320.42 g/mol |
| Exact Mass | 320.13 |
| IUPAC Name | 1-(1,3-dimethylpyrazol-4-yl)sulfonyl-4-phenylpiperazine |
| SMILES | Cc1nn(C)cc1S(=O)(=O)N1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C15H20N4O2S/c1-13-15(12-17(2)16-13)22(20,21)19-10-8-18(9-11-19)14-6-4-3-5-7-14/h3-7,12H,8-11H2,1-2H3 |
| InChIKey | NBRXFILZRNHUMU-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 58.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.42 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |