About N-cyclohexyl-6-methyl-3,4-dihydro-2H-quinoline-1-carboxamide
N-cyclohexyl-6-methyl-3,4-dihydro-2H-quinoline-1-carboxamide (PubChem CID 6467963) has the molecular formula C17H24N2O
and a molecular weight of 272.39 g/mol. Its IUPAC name is N-cyclohexyl-6-methyl-3,4-dihydro-2H-quinoline-1-carboxamide.
Molecular Properties
| Compound Name | N-cyclohexyl-6-methyl-3,4-dihydro-2H-quinoline-1-carboxamide |
| PubChem CID | 6467963 |
| Molecular Formula | C17H24N2O |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.19 |
| IUPAC Name | N-cyclohexyl-6-methyl-3,4-dihydro-2H-quinoline-1-carboxamide |
| SMILES | Cc1ccc2c(c1)CCCN2C(=O)NC1CCCCC1 |
| InChI | InChI=1S/C17H24N2O/c1-13-9-10-16-14(12-13)6-5-11-19(16)17(20)18-15-7-3-2-4-8-15/h9-10,12,15H,2-8,11H2,1H3,(H,18,20) |
| InChIKey | UJSHJIOXUTUXNF-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-cyclohexyl-6-methyl-3,4-dihydro-2H-quinoline-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclohexyl-6-methyl-3,4-dihydro-2H-quinoline-1-carboxamide?
The IUPAC name of N-cyclohexyl-6-methyl-3,4-dihydro-2H-quinoline-1-carboxamide (CID 6467963) is N-cyclohexyl-6-methyl-3,4-dihydro-2H-quinoline-1-carboxamide.
What is the SMILES notation for N-cyclohexyl-6-methyl-3,4-dihydro-2H-quinoline-1-carboxamide?
The canonical SMILES for N-cyclohexyl-6-methyl-3,4-dihydro-2H-quinoline-1-carboxamide is Cc1ccc2c(c1)CCCN2C(=O)NC1CCCCC1.
What is the InChIKey of N-cyclohexyl-6-methyl-3,4-dihydro-2H-quinoline-1-carboxamide?
The InChIKey is UJSHJIOXUTUXNF-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H24N2O/c1-13-9-10-16-14(12-13)6-5-11-19(16)17(20)18-15-7-3-2-4-8-15/h9-10,12,15H,2-8,11H2,1H3,(H,18,20).
What are the key properties of N-cyclohexyl-6-methyl-3,4-dihydro-2H-quinoline-1-carboxamide?
N-cyclohexyl-6-methyl-3,4-dihydro-2H-quinoline-1-carboxamide has a molecular weight of 272.39 g/mol, XLogP of 3.79, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclohexyl-6-methyl-3,4-dihydro-2H-quinoline-1-carboxamide is sourced from PubChem (CID 6467963), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).