C11H10FNO2 — CID 64680605
3-(2,5-dihydropyrrol-1-yl)-4-fluorobenzoic acid (PubChem CID 64680605) has the molecular formula C11H10FNO2 and a molecular weight of 207.20 g/mol. Its IUPAC name is 3-(2,5-dihydropyrrol-1-yl)-4-fluorobenzoic acid.
| Compound Name | 3-(2,5-dihydropyrrol-1-yl)-4-fluorobenzoic acid |
|---|---|
| PubChem CID | 64680605 |
| Molecular Formula | C11H10FNO2 |
| Molecular Weight | 207.20 g/mol |
| Exact Mass | 207.07 |
| IUPAC Name | 3-(2,5-dihydropyrrol-1-yl)-4-fluorobenzoic acid |
| SMILES | O=C(O)c1ccc(F)c(N2CC=CC2)c1 |
| InChI | InChI=1S/C11H10FNO2/c12-9-4-3-8(11(14)15)7-10(9)13-5-1-2-6-13/h1-4,7H,5-6H2,(H,14,15) |
| InChIKey | QKMUFINVFRSLIO-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.20 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|