C15H30N2O3 — CID 64688531
tert-butyl 2-[4-(2-hydroxy-2-methylpropyl)piperazin-1-yl]propanoate (PubChem CID 64688531) has the molecular formula C15H30N2O3 and a molecular weight of 286.42 g/mol. Its IUPAC name is tert-butyl 2-[4-(2-hydroxy-2-methylpropyl)piperazin-1-yl]propanoate.
| Compound Name | tert-butyl 2-[4-(2-hydroxy-2-methylpropyl)piperazin-1-yl]propanoate |
|---|---|
| PubChem CID | 64688531 |
| Molecular Formula | C15H30N2O3 |
| Molecular Weight | 286.42 g/mol |
| Exact Mass | 286.23 |
| IUPAC Name | tert-butyl 2-[4-(2-hydroxy-2-methylpropyl)piperazin-1-yl]propanoate |
| SMILES | CC(C(=O)OC(C)(C)C)N1CCN(CC(C)(C)O)CC1 |
| InChI | InChI=1S/C15H30N2O3/c1-12(13(18)20-14(2,3)4)17-9-7-16(8-10-17)11-15(5,6)19/h12,19H,7-11H2,1-6H3 |
| InChIKey | VBXLAPJZJHZTSL-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.42 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |