C15H29NO2 — CID 65438547
tert-butyl 2-(4,4-dimethylazepan-1-yl)propanoate (PubChem CID 65438547) has the molecular formula C15H29NO2 and a molecular weight of 255.40 g/mol. Its IUPAC name is tert-butyl 2-(4,4-dimethylazepan-1-yl)propanoate.
| Compound Name | tert-butyl 2-(4,4-dimethylazepan-1-yl)propanoate |
|---|---|
| PubChem CID | 65438547 |
| Molecular Formula | C15H29NO2 |
| Molecular Weight | 255.40 g/mol |
| Exact Mass | 255.22 |
| IUPAC Name | tert-butyl 2-(4,4-dimethylazepan-1-yl)propanoate |
| SMILES | CC(C(=O)OC(C)(C)C)N1CCCC(C)(C)CC1 |
| InChI | InChI=1S/C15H29NO2/c1-12(13(17)18-14(2,3)4)16-10-7-8-15(5,6)9-11-16/h12H,7-11H2,1-6H3 |
| InChIKey | QAQYBUJEAGTUQI-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.40 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |