C13H25NO2 — CID 64688779
tert-butyl 2-(2,2-dimethylpyrrolidin-1-yl)propanoate (PubChem CID 64688779) has the molecular formula C13H25NO2 and a molecular weight of 227.35 g/mol. Its IUPAC name is tert-butyl 2-(2,2-dimethylpyrrolidin-1-yl)propanoate.
| Compound Name | tert-butyl 2-(2,2-dimethylpyrrolidin-1-yl)propanoate |
|---|---|
| PubChem CID | 64688779 |
| Molecular Formula | C13H25NO2 |
| Molecular Weight | 227.35 g/mol |
| Exact Mass | 227.19 |
| IUPAC Name | tert-butyl 2-(2,2-dimethylpyrrolidin-1-yl)propanoate |
| SMILES | CC(C(=O)OC(C)(C)C)N1CCCC1(C)C |
| InChI | InChI=1S/C13H25NO2/c1-10(11(15)16-12(2,3)4)14-9-7-8-13(14,5)6/h10H,7-9H2,1-6H3 |
| InChIKey | XVYVWUNHTRJXAZ-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.35 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |