C17H32N2O — CID 99811252
(2R)-1-(azepan-1-yl)-2-(4,4-dimethylazepan-1-yl)propan-1-one (PubChem CID 99811252) has the molecular formula C17H32N2O and a molecular weight of 280.46 g/mol. Its IUPAC name is (2R)-1-(azepan-1-yl)-2-(4,4-dimethylazepan-1-yl)propan-1-one.
| Compound Name | (2R)-1-(azepan-1-yl)-2-(4,4-dimethylazepan-1-yl)propan-1-one |
|---|---|
| PubChem CID | 99811252 |
| Molecular Formula | C17H32N2O |
| Molecular Weight | 280.46 g/mol |
| Exact Mass | 280.25 |
| IUPAC Name | (2R)-1-(azepan-1-yl)-2-(4,4-dimethylazepan-1-yl)propan-1-one |
| SMILES | C[C@H](C(=O)N1CCCCCC1)N1CCCC(C)(C)CC1 |
| InChI | InChI=1S/C17H32N2O/c1-15(16(20)19-11-6-4-5-7-12-19)18-13-8-9-17(2,3)10-14-18/h15H,4-14H2,1-3H3/t15-/m1/s1 |
| InChIKey | PPZAAINAXUHDBQ-OAHLLOKOSA-N |
| XLogP | 3.29 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.46 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |