C14H16N2O4S — CID 64690218
N-(3-cyanophenyl)-2-(oxan-4-ylsulfonyl)acetamide (PubChem CID 64690218) has the molecular formula C14H16N2O4S and a molecular weight of 308.36 g/mol. Its IUPAC name is N-(3-cyanophenyl)-2-(oxan-4-ylsulfonyl)acetamide.
| Compound Name | N-(3-cyanophenyl)-2-(oxan-4-ylsulfonyl)acetamide |
|---|---|
| PubChem CID | 64690218 |
| Molecular Formula | C14H16N2O4S |
| Molecular Weight | 308.36 g/mol |
| Exact Mass | 308.08 |
| IUPAC Name | N-(3-cyanophenyl)-2-(oxan-4-ylsulfonyl)acetamide |
| SMILES | N#Cc1cccc(NC(=O)CS(=O)(=O)C2CCOCC2)c1 |
| InChI | InChI=1S/C14H16N2O4S/c15-9-11-2-1-3-12(8-11)16-14(17)10-21(18,19)13-4-6-20-7-5-13/h1-3,8,13H,4-7,10H2,(H,16,17) |
| InChIKey | AQAKXUWNBGMKGH-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 96.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.36 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |