C14H18N2O4S — CID 64690595
N-(2-cyanophenyl)-4-(2-methoxyethylsulfonyl)butanamide (PubChem CID 64690595) has the molecular formula C14H18N2O4S and a molecular weight of 310.37 g/mol. Its IUPAC name is N-(2-cyanophenyl)-4-(2-methoxyethylsulfonyl)butanamide.
| Compound Name | N-(2-cyanophenyl)-4-(2-methoxyethylsulfonyl)butanamide |
|---|---|
| PubChem CID | 64690595 |
| Molecular Formula | C14H18N2O4S |
| Molecular Weight | 310.37 g/mol |
| Exact Mass | 310.10 |
| IUPAC Name | N-(2-cyanophenyl)-4-(2-methoxyethylsulfonyl)butanamide |
| SMILES | COCCS(=O)(=O)CCCC(=O)Nc1ccccc1C#N |
| InChI | InChI=1S/C14H18N2O4S/c1-20-8-10-21(18,19)9-4-7-14(17)16-13-6-3-2-5-12(13)11-15/h2-3,5-6H,4,7-10H2,1H3,(H,16,17) |
| InChIKey | XPCJWQMFFSEZFT-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 96.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.37 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |