C13H13Cl2NOS — CID 64690873
2-(2,5-dichlorophenyl)sulfinylcyclohexane-1-carbonitrile (PubChem CID 64690873) has the molecular formula C13H13Cl2NOS and a molecular weight of 302.23 g/mol. Its IUPAC name is 2-(2,5-dichlorophenyl)sulfinylcyclohexane-1-carbonitrile.
| Compound Name | 2-(2,5-dichlorophenyl)sulfinylcyclohexane-1-carbonitrile |
|---|---|
| PubChem CID | 64690873 |
| Molecular Formula | C13H13Cl2NOS |
| Molecular Weight | 302.23 g/mol |
| Exact Mass | 301.01 |
| IUPAC Name | 2-(2,5-dichlorophenyl)sulfinylcyclohexane-1-carbonitrile |
| SMILES | N#CC1CCCCC1S(=O)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C13H13Cl2NOS/c14-10-5-6-11(15)13(7-10)18(17)12-4-2-1-3-9(12)8-16/h5-7,9,12H,1-4H2 |
| InChIKey | SFONGIBBWDEXSV-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.23 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |