C10H9Cl2N3 — CID 64692164
6-(2,6-dichlorophenyl)-4,5-dihydropyridazin-3-amine (PubChem CID 64692164) has the molecular formula C10H9Cl2N3 and a molecular weight of 242.11 g/mol. Its IUPAC name is 6-(2,6-dichlorophenyl)-4,5-dihydropyridazin-3-amine.
| Compound Name | 6-(2,6-dichlorophenyl)-4,5-dihydropyridazin-3-amine |
|---|---|
| PubChem CID | 64692164 |
| Molecular Formula | C10H9Cl2N3 |
| Molecular Weight | 242.11 g/mol |
| Exact Mass | 241.02 |
| IUPAC Name | 6-(2,6-dichlorophenyl)-4,5-dihydropyridazin-3-amine |
| SMILES | NC1=NN=C(c2c(Cl)cccc2Cl)CC1 |
| InChI | InChI=1S/C10H9Cl2N3/c11-6-2-1-3-7(12)10(6)8-4-5-9(13)15-14-8/h1-3H,4-5H2,(H2,13,15) |
| InChIKey | MMIWRCNRSAQXEG-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 50.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.11 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |