C15H23NO3S — CID 64696416
[3-(3-cyclopentylsulfonylpropoxy)phenyl]methanamine (PubChem CID 64696416) has the molecular formula C15H23NO3S and a molecular weight of 297.42 g/mol. Its IUPAC name is [3-(3-cyclopentylsulfonylpropoxy)phenyl]methanamine.
| Compound Name | [3-(3-cyclopentylsulfonylpropoxy)phenyl]methanamine |
|---|---|
| PubChem CID | 64696416 |
| Molecular Formula | C15H23NO3S |
| Molecular Weight | 297.42 g/mol |
| Exact Mass | 297.14 |
| IUPAC Name | [3-(3-cyclopentylsulfonylpropoxy)phenyl]methanamine |
| SMILES | NCc1cccc(OCCCS(=O)(=O)C2CCCC2)c1 |
| InChI | InChI=1S/C15H23NO3S/c16-12-13-5-3-6-14(11-13)19-9-4-10-20(17,18)15-7-1-2-8-15/h3,5-6,11,15H,1-2,4,7-10,12,16H2 |
| InChIKey | VCEHPTAJESXCGW-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.42 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|