C15H12N2O — CID 647027
2-(furan-2-yl)-2,3-dihydro-1H-perimidine (PubChem CID 647027) has the molecular formula C15H12N2O and a molecular weight of 236.27 g/mol. Its IUPAC name is 2-(furan-2-yl)-2,3-dihydro-1H-perimidine.
| Compound Name | 2-(furan-2-yl)-2,3-dihydro-1H-perimidine |
|---|---|
| PubChem CID | 647027 |
| Molecular Formula | C15H12N2O |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.09 |
| IUPAC Name | 2-(furan-2-yl)-2,3-dihydro-1H-perimidine |
| SMILES | c1coc(C2Nc3cccc4cccc(c34)N2)c1 |
| InChI | InChI=1S/C15H12N2O/c1-4-10-5-2-7-12-14(10)11(6-1)16-15(17-12)13-8-3-9-18-13/h1-9,15-17H |
| InChIKey | ULYJQHBTOHTGKS-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 37.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'naphth_amino_B(25)', 'substructure': 'N/A'} |
|---|