C12H10N2O2 — CID 656251
2-(furan-2-yl)-2,3-dihydro-1H-quinazolin-4-one (PubChem CID 656251) has the molecular formula C12H10N2O2 and a molecular weight of 214.22 g/mol. Its IUPAC name is 2-(furan-2-yl)-2,3-dihydro-1H-quinazolin-4-one.
| Compound Name | 2-(furan-2-yl)-2,3-dihydro-1H-quinazolin-4-one |
|---|---|
| PubChem CID | 656251 |
| Molecular Formula | C12H10N2O2 |
| Molecular Weight | 214.22 g/mol |
| Exact Mass | 214.07 |
| IUPAC Name | 2-(furan-2-yl)-2,3-dihydro-1H-quinazolin-4-one |
| SMILES | O=C1NC(c2ccco2)Nc2ccccc21 |
| InChI | InChI=1S/C12H10N2O2/c15-12-8-4-1-2-5-9(8)13-11(14-12)10-6-3-7-16-10/h1-7,11,13H,(H,14,15) |
| InChIKey | QCRTXSVKRLCOBJ-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 54.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.22 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |