C15H27N3O2S — CID 64703505
ethyl 2-methyl-4-(1-methylpyrazol-4-yl)sulfanyl-2-(propylamino)pentanoate (PubChem CID 64703505) has the molecular formula C15H27N3O2S and a molecular weight of 313.47 g/mol. Its IUPAC name is ethyl 2-methyl-4-(1-methylpyrazol-4-yl)sulfanyl-2-(propylamino)pentanoate.
| Compound Name | ethyl 2-methyl-4-(1-methylpyrazol-4-yl)sulfanyl-2-(propylamino)pentanoate |
|---|---|
| PubChem CID | 64703505 |
| Molecular Formula | C15H27N3O2S |
| Molecular Weight | 313.47 g/mol |
| Exact Mass | 313.18 |
| IUPAC Name | ethyl 2-methyl-4-(1-methylpyrazol-4-yl)sulfanyl-2-(propylamino)pentanoate |
| SMILES | CCCNC(C)(CC(C)Sc1cnn(C)c1)C(=O)OCC |
| InChI | InChI=1S/C15H27N3O2S/c1-6-8-16-15(4,14(19)20-7-2)9-12(3)21-13-10-17-18(5)11-13/h10-12,16H,6-9H2,1-5H3 |
| InChIKey | NMJNGLRUSMUWPU-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.47 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |