C14H29NO4S2 — CID 64704559
ethyl 2-methyl-4-(2-methylsulfonylethylsulfanyl)-2-(propylamino)pentanoate (PubChem CID 64704559) has the molecular formula C14H29NO4S2 and a molecular weight of 339.52 g/mol. Its IUPAC name is ethyl 2-methyl-4-(2-methylsulfonylethylsulfanyl)-2-(propylamino)pentanoate.
| Compound Name | ethyl 2-methyl-4-(2-methylsulfonylethylsulfanyl)-2-(propylamino)pentanoate |
|---|---|
| PubChem CID | 64704559 |
| Molecular Formula | C14H29NO4S2 |
| Molecular Weight | 339.52 g/mol |
| Exact Mass | 339.15 |
| IUPAC Name | ethyl 2-methyl-4-(2-methylsulfonylethylsulfanyl)-2-(propylamino)pentanoate |
| SMILES | CCCNC(C)(CC(C)SCCS(C)(=O)=O)C(=O)OCC |
| InChI | InChI=1S/C14H29NO4S2/c1-6-8-15-14(4,13(16)19-7-2)11-12(3)20-9-10-21(5,17)18/h12,15H,6-11H2,1-5H3 |
| InChIKey | UNCUFKQHNFZLDW-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.52 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |