C14H25N3O2 — CID 64704252
ethyl 2-amino-2-methyl-4-(2-propan-2-ylimidazol-1-yl)pentanoate (PubChem CID 64704252) has the molecular formula C14H25N3O2 and a molecular weight of 267.37 g/mol. Its IUPAC name is ethyl 2-amino-2-methyl-4-(2-propan-2-ylimidazol-1-yl)pentanoate.
| Compound Name | ethyl 2-amino-2-methyl-4-(2-propan-2-ylimidazol-1-yl)pentanoate |
|---|---|
| PubChem CID | 64704252 |
| Molecular Formula | C14H25N3O2 |
| Molecular Weight | 267.37 g/mol |
| Exact Mass | 267.19 |
| IUPAC Name | ethyl 2-amino-2-methyl-4-(2-propan-2-ylimidazol-1-yl)pentanoate |
| SMILES | CCOC(=O)C(C)(N)CC(C)n1ccnc1C(C)C |
| InChI | InChI=1S/C14H25N3O2/c1-6-19-13(18)14(5,15)9-11(4)17-8-7-16-12(17)10(2)3/h7-8,10-11H,6,9,15H2,1-5H3 |
| InChIKey | WFJGMNPGXFSMJT-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 70.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.37 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |