C15H28N4O — CID 64704254
2-methyl-4-(2-propan-2-ylimidazol-1-yl)-2-(propylamino)pentanamide (PubChem CID 64704254) has the molecular formula C15H28N4O and a molecular weight of 280.42 g/mol. Its IUPAC name is 2-methyl-4-(2-propan-2-ylimidazol-1-yl)-2-(propylamino)pentanamide.
| Compound Name | 2-methyl-4-(2-propan-2-ylimidazol-1-yl)-2-(propylamino)pentanamide |
|---|---|
| PubChem CID | 64704254 |
| Molecular Formula | C15H28N4O |
| Molecular Weight | 280.42 g/mol |
| Exact Mass | 280.23 |
| IUPAC Name | 2-methyl-4-(2-propan-2-ylimidazol-1-yl)-2-(propylamino)pentanamide |
| SMILES | CCCNC(C)(CC(C)n1ccnc1C(C)C)C(N)=O |
| InChI | InChI=1S/C15H28N4O/c1-6-7-18-15(5,14(16)20)10-12(4)19-9-8-17-13(19)11(2)3/h8-9,11-12,18H,6-7,10H2,1-5H3,(H2,16,20) |
| InChIKey | LDHUWHZETFYFNS-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.42 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |