C14H22ClN3O2 — CID 64705271
ethyl 4-(4-chloropyrazol-1-yl)-2-(cyclopropylamino)-2-methylpentanoate (PubChem CID 64705271) has the molecular formula C14H22ClN3O2 and a molecular weight of 299.80 g/mol. Its IUPAC name is ethyl 4-(4-chloropyrazol-1-yl)-2-(cyclopropylamino)-2-methylpentanoate.
| Compound Name | ethyl 4-(4-chloropyrazol-1-yl)-2-(cyclopropylamino)-2-methylpentanoate |
|---|---|
| PubChem CID | 64705271 |
| Molecular Formula | C14H22ClN3O2 |
| Molecular Weight | 299.80 g/mol |
| Exact Mass | 299.14 |
| IUPAC Name | ethyl 4-(4-chloropyrazol-1-yl)-2-(cyclopropylamino)-2-methylpentanoate |
| SMILES | CCOC(=O)C(C)(CC(C)n1cc(Cl)cn1)NC1CC1 |
| InChI | InChI=1S/C14H22ClN3O2/c1-4-20-13(19)14(3,17-12-5-6-12)7-10(2)18-9-11(15)8-16-18/h8-10,12,17H,4-7H2,1-3H3 |
| InChIKey | IPFRUWNKDDRJQP-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.80 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |