C12H22ClN3O — CID 64809659
4-(4-chloropyrazol-1-yl)-2-methyl-2-(propylamino)pentan-1-ol (PubChem CID 64809659) has the molecular formula C12H22ClN3O and a molecular weight of 259.78 g/mol. Its IUPAC name is 4-(4-chloropyrazol-1-yl)-2-methyl-2-(propylamino)pentan-1-ol.
| Compound Name | 4-(4-chloropyrazol-1-yl)-2-methyl-2-(propylamino)pentan-1-ol |
|---|---|
| PubChem CID | 64809659 |
| Molecular Formula | C12H22ClN3O |
| Molecular Weight | 259.78 g/mol |
| Exact Mass | 259.15 |
| IUPAC Name | 4-(4-chloropyrazol-1-yl)-2-methyl-2-(propylamino)pentan-1-ol |
| SMILES | CCCNC(C)(CO)CC(C)n1cc(Cl)cn1 |
| InChI | InChI=1S/C12H22ClN3O/c1-4-5-14-12(3,9-17)6-10(2)16-8-11(13)7-15-16/h7-8,10,14,17H,4-6,9H2,1-3H3 |
| InChIKey | ZVBPMYPYPYPFRD-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.78 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |