C14H21N3S — CID 64707252
N-ethyl-4-(2-thiophen-2-ylimidazol-1-yl)pentan-2-amine (PubChem CID 64707252) has the molecular formula C14H21N3S and a molecular weight of 263.41 g/mol. Its IUPAC name is N-ethyl-4-(2-thiophen-2-ylimidazol-1-yl)pentan-2-amine.
| Compound Name | N-ethyl-4-(2-thiophen-2-ylimidazol-1-yl)pentan-2-amine |
|---|---|
| PubChem CID | 64707252 |
| Molecular Formula | C14H21N3S |
| Molecular Weight | 263.41 g/mol |
| Exact Mass | 263.15 |
| IUPAC Name | N-ethyl-4-(2-thiophen-2-ylimidazol-1-yl)pentan-2-amine |
| SMILES | CCNC(C)CC(C)n1ccnc1-c1cccs1 |
| InChI | InChI=1S/C14H21N3S/c1-4-15-11(2)10-12(3)17-8-7-16-14(17)13-6-5-9-18-13/h5-9,11-12,15H,4,10H2,1-3H3 |
| InChIKey | ZJVBTJFEORADCQ-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.41 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |