C12H21NS — CID 64720964
N,4-dimethyl-6-thiophen-2-ylhexan-2-amine (PubChem CID 64720964) has the molecular formula C12H21NS and a molecular weight of 211.37 g/mol. Its IUPAC name is N,4-dimethyl-6-thiophen-2-ylhexan-2-amine.
| Compound Name | N,4-dimethyl-6-thiophen-2-ylhexan-2-amine |
|---|---|
| PubChem CID | 64720964 |
| Molecular Formula | C12H21NS |
| Molecular Weight | 211.37 g/mol |
| Exact Mass | 211.14 |
| IUPAC Name | N,4-dimethyl-6-thiophen-2-ylhexan-2-amine |
| SMILES | CNC(C)CC(C)CCc1cccs1 |
| InChI | InChI=1S/C12H21NS/c1-10(9-11(2)13-3)6-7-12-5-4-8-14-12/h4-5,8,10-11,13H,6-7,9H2,1-3H3 |
| InChIKey | OKIYRGRGRBHSMP-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.37 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |