About 6-bromo-2-(1,3-dihydro-2-benzofuran-5-yl)-1H-benzimidazole
6-bromo-2-(1,3-dihydro-2-benzofuran-5-yl)-1H-benzimidazole (PubChem CID 64723325) has the molecular formula C15H11BrN2O
and a molecular weight of 315.17 g/mol. Its IUPAC name is 6-bromo-2-(1,3-dihydro-2-benzofuran-5-yl)-1H-benzimidazole.
Molecular Properties
| Compound Name | 6-bromo-2-(1,3-dihydro-2-benzofuran-5-yl)-1H-benzimidazole |
| PubChem CID | 64723325 |
| Molecular Formula | C15H11BrN2O |
| Molecular Weight | 315.17 g/mol |
| Exact Mass | 314.01 |
| IUPAC Name | 6-bromo-2-(1,3-dihydro-2-benzofuran-5-yl)-1H-benzimidazole |
| SMILES | Brc1ccc2nc(-c3ccc4c(c3)COC4)[nH]c2c1 |
| InChI | InChI=1S/C15H11BrN2O/c16-12-3-4-13-14(6-12)18-15(17-13)9-1-2-10-7-19-8-11(10)5-9/h1-6H,7-8H2,(H,17,18) |
| InChIKey | PNBMVRJGLCGWHA-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.17 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-bromo-2-(1,3-dihydro-2-benzofuran-5-yl)-1H-benzimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-2-(1,3-dihydro-2-benzofuran-5-yl)-1H-benzimidazole?
The IUPAC name of 6-bromo-2-(1,3-dihydro-2-benzofuran-5-yl)-1H-benzimidazole (CID 64723325) is 6-bromo-2-(1,3-dihydro-2-benzofuran-5-yl)-1H-benzimidazole.
What is the SMILES notation for 6-bromo-2-(1,3-dihydro-2-benzofuran-5-yl)-1H-benzimidazole?
The canonical SMILES for 6-bromo-2-(1,3-dihydro-2-benzofuran-5-yl)-1H-benzimidazole is Brc1ccc2nc(-c3ccc4c(c3)COC4)[nH]c2c1.
What is the InChIKey of 6-bromo-2-(1,3-dihydro-2-benzofuran-5-yl)-1H-benzimidazole?
The InChIKey is PNBMVRJGLCGWHA-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11BrN2O/c16-12-3-4-13-14(6-12)18-15(17-13)9-1-2-10-7-19-8-11(10)5-9/h1-6H,7-8H2,(H,17,18).
What are the key properties of 6-bromo-2-(1,3-dihydro-2-benzofuran-5-yl)-1H-benzimidazole?
6-bromo-2-(1,3-dihydro-2-benzofuran-5-yl)-1H-benzimidazole has a molecular weight of 315.17 g/mol, XLogP of 4.02, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-2-(1,3-dihydro-2-benzofuran-5-yl)-1H-benzimidazole is sourced from PubChem (CID 64723325), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).