C9H16O5S2 — CID 64724653
3-(2-methylsulfonylethylsulfonyl)cyclohexan-1-one (PubChem CID 64724653) has the molecular formula C9H16O5S2 and a molecular weight of 268.36 g/mol. Its IUPAC name is 3-(2-methylsulfonylethylsulfonyl)cyclohexan-1-one.
| Compound Name | 3-(2-methylsulfonylethylsulfonyl)cyclohexan-1-one |
|---|---|
| PubChem CID | 64724653 |
| Molecular Formula | C9H16O5S2 |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.04 |
| IUPAC Name | 3-(2-methylsulfonylethylsulfonyl)cyclohexan-1-one |
| SMILES | CS(=O)(=O)CCS(=O)(=O)C1CCCC(=O)C1 |
| InChI | InChI=1S/C9H16O5S2/c1-15(11,12)5-6-16(13,14)9-4-2-3-8(10)7-9/h9H,2-7H2,1H3 |
| InChIKey | PSTMYSABTUPOQQ-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 85.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |