C18H28O2 — CID 64728664
(3,5-dimethylcyclohexyl)-(4-propoxyphenyl)methanol (PubChem CID 64728664) has the molecular formula C18H28O2 and a molecular weight of 276.42 g/mol. Its IUPAC name is (3,5-dimethylcyclohexyl)-(4-propoxyphenyl)methanol.
| Compound Name | (3,5-dimethylcyclohexyl)-(4-propoxyphenyl)methanol |
|---|---|
| PubChem CID | 64728664 |
| Molecular Formula | C18H28O2 |
| Molecular Weight | 276.42 g/mol |
| Exact Mass | 276.21 |
| IUPAC Name | (3,5-dimethylcyclohexyl)-(4-propoxyphenyl)methanol |
| SMILES | CCCOc1ccc(C(O)C2CC(C)CC(C)C2)cc1 |
| InChI | InChI=1S/C18H28O2/c1-4-9-20-17-7-5-15(6-8-17)18(19)16-11-13(2)10-14(3)12-16/h5-8,13-14,16,18-19H,4,9-12H2,1-3H3 |
| InChIKey | GPVUEPGRPNXNSI-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.42 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |