C11H20O2 — CID 64729888
1-(3,5-dimethylcyclohexyl)-2-methoxyethanone (PubChem CID 64729888) has the molecular formula C11H20O2 and a molecular weight of 184.28 g/mol. Its IUPAC name is 1-(3,5-dimethylcyclohexyl)-2-methoxyethanone.
| Compound Name | 1-(3,5-dimethylcyclohexyl)-2-methoxyethanone |
|---|---|
| PubChem CID | 64729888 |
| Molecular Formula | C11H20O2 |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.15 |
| IUPAC Name | 1-(3,5-dimethylcyclohexyl)-2-methoxyethanone |
| SMILES | COCC(=O)C1CC(C)CC(C)C1 |
| InChI | InChI=1S/C11H20O2/c1-8-4-9(2)6-10(5-8)11(12)7-13-3/h8-10H,4-7H2,1-3H3 |
| InChIKey | PTDOHJWAKQWBCS-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |