C12H22OS — CID 65131203
1-(3,5-dimethylcyclohexyl)-2-ethylsulfanylethanone (PubChem CID 65131203) has the molecular formula C12H22OS and a molecular weight of 214.37 g/mol. Its IUPAC name is 1-(3,5-dimethylcyclohexyl)-2-ethylsulfanylethanone.
| Compound Name | 1-(3,5-dimethylcyclohexyl)-2-ethylsulfanylethanone |
|---|---|
| PubChem CID | 65131203 |
| Molecular Formula | C12H22OS |
| Molecular Weight | 214.37 g/mol |
| Exact Mass | 214.14 |
| IUPAC Name | 1-(3,5-dimethylcyclohexyl)-2-ethylsulfanylethanone |
| SMILES | CCSCC(=O)C1CC(C)CC(C)C1 |
| InChI | InChI=1S/C12H22OS/c1-4-14-8-12(13)11-6-9(2)5-10(3)7-11/h9-11H,4-8H2,1-3H3 |
| InChIKey | LAXCRWQVXIWKCG-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.37 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |