C16H21BrO2 — CID 64729994
1-[3-bromo-4-(3,5-dimethylcyclohexyl)oxyphenyl]ethanone (PubChem CID 64729994) has the molecular formula C16H21BrO2 and a molecular weight of 325.25 g/mol. Its IUPAC name is 1-[3-bromo-4-(3,5-dimethylcyclohexyl)oxyphenyl]ethanone.
| Compound Name | 1-[3-bromo-4-(3,5-dimethylcyclohexyl)oxyphenyl]ethanone |
|---|---|
| PubChem CID | 64729994 |
| Molecular Formula | C16H21BrO2 |
| Molecular Weight | 325.25 g/mol |
| Exact Mass | 324.07 |
| IUPAC Name | 1-[3-bromo-4-(3,5-dimethylcyclohexyl)oxyphenyl]ethanone |
| SMILES | CC(=O)c1ccc(OC2CC(C)CC(C)C2)c(Br)c1 |
| InChI | InChI=1S/C16H21BrO2/c1-10-6-11(2)8-14(7-10)19-16-5-4-13(12(3)18)9-15(16)17/h4-5,9-11,14H,6-8H2,1-3H3 |
| InChIKey | QLTCIUZGTZUZMO-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.25 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |