About 5-[(3,5-dimethylcyclohexyl)oxymethyl]-1,2-oxazole-3-carboxylic acid
5-[(3,5-dimethylcyclohexyl)oxymethyl]-1,2-oxazole-3-carboxylic acid (PubChem CID 64730368) has the molecular formula C13H19NO4
and a molecular weight of 253.30 g/mol. Its IUPAC name is 5-[(3,5-dimethylcyclohexyl)oxymethyl]-1,2-oxazole-3-carboxylic acid.
Molecular Properties
| Compound Name | 5-[(3,5-dimethylcyclohexyl)oxymethyl]-1,2-oxazole-3-carboxylic acid |
| PubChem CID | 64730368 |
| Molecular Formula | C13H19NO4 |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.13 |
| IUPAC Name | 5-[(3,5-dimethylcyclohexyl)oxymethyl]-1,2-oxazole-3-carboxylic acid |
| SMILES | CC1CC(C)CC(OCc2cc(C(=O)O)no2)C1 |
| InChI | InChI=1S/C13H19NO4/c1-8-3-9(2)5-10(4-8)17-7-11-6-12(13(15)16)14-18-11/h6,8-10H,3-5,7H2,1-2H3,(H,15,16) |
| InChIKey | SSYKUBAAXPVFCA-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 72.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-[(3,5-dimethylcyclohexyl)oxymethyl]-1,2-oxazole-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(3,5-dimethylcyclohexyl)oxymethyl]-1,2-oxazole-3-carboxylic acid?
The IUPAC name of 5-[(3,5-dimethylcyclohexyl)oxymethyl]-1,2-oxazole-3-carboxylic acid (CID 64730368) is 5-[(3,5-dimethylcyclohexyl)oxymethyl]-1,2-oxazole-3-carboxylic acid.
What is the SMILES notation for 5-[(3,5-dimethylcyclohexyl)oxymethyl]-1,2-oxazole-3-carboxylic acid?
The canonical SMILES for 5-[(3,5-dimethylcyclohexyl)oxymethyl]-1,2-oxazole-3-carboxylic acid is CC1CC(C)CC(OCc2cc(C(=O)O)no2)C1.
What is the InChIKey of 5-[(3,5-dimethylcyclohexyl)oxymethyl]-1,2-oxazole-3-carboxylic acid?
The InChIKey is SSYKUBAAXPVFCA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19NO4/c1-8-3-9(2)5-10(4-8)17-7-11-6-12(13(15)16)14-18-11/h6,8-10H,3-5,7H2,1-2H3,(H,15,16).
What are the key properties of 5-[(3,5-dimethylcyclohexyl)oxymethyl]-1,2-oxazole-3-carboxylic acid?
5-[(3,5-dimethylcyclohexyl)oxymethyl]-1,2-oxazole-3-carboxylic acid has a molecular weight of 253.30 g/mol, XLogP of 2.71, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(3,5-dimethylcyclohexyl)oxymethyl]-1,2-oxazole-3-carboxylic acid is sourced from PubChem (CID 64730368), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).